For research use only. Not for therapeutic Use.
Ethyl 2-Cyanopropanoate is an organic compound featuring an ester and nitrile group attached to a propanoate backbone. This versatile molecule is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Its ester group allows for various chemical transformations, such as hydrolysis and transesterification, while the nitrile group offers reactivity for creating more complex compounds. Ethyl 2-Cyanopropanoate is valuable in developing bioactive molecules and in research aimed at creating new chemical entities for therapeutic use.
CAS Number | 1572-99-2 |
Synonyms | 2-Cyanopropanoic Acid Ethyl Ester; Ethyl 2-Cyanopropionate; Ethyl α-Cyanopropionate; NSC 68508 |
Molecular Formula | C6H9NO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | ethyl 2-cyanopropanoate |
InChI | InChI=1S/C6H9NO2/c1-3-9-6(8)5(2)4-7/h5H,3H2,1-2H3 |
InChIKey | MIHRVXYXORIINI-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(C)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |