For research use only. Not for therapeutic Use.
Ethyl 2-pyridylacetate(CAT: L011393) is an ester derivative containing a pyridine ring attached to an acetic acid ester. This compound is commonly used as an intermediate in organic synthesis, particularly in pharmaceutical and agrochemical research, due to its pyridine moiety and ester functionality. The ester group enables hydrolysis, transesterification, or other modifications, allowing researchers to explore derivatives that can lead to bioactive molecules. The pyridine ring, meanwhile, offers nitrogen-based coordination, making it suitable for synthesizing ligands, catalysts, and metal-binding compounds. Ethyl 2-pyridylacetate is a versatile building block for designing novel chemical entities in drug discovery and materials science.
| CAS Number | 2739-98-2 |
| Molecular Formula | C9H11NO2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-pyridin-2-ylacetate |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-8-5-3-4-6-10-8/h3-6H,2,7H2,1H3 |
| InChIKey | IUDKTVXSXWAKJO-UHFFFAOYSA-N |
