For research use only. Not for therapeutic Use.
Ethyl 2,3-dichloroisonicotinate (Cat.No:L003569) is a significant chemical compound in pharmaceutical research. Its unique structure, featuring dichlorinated pyridine, lends itself to various synthetic transformations. This compound serves as a key intermediate in the production of biologically active molecules, making it invaluable in drug discovery endeavors.
| Catalog Number | L003569 |
| CAS Number | 1092353-03-1 |
| Molecular Formula | C8H7Cl2NO2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2,3-dichloropyridine-4-carboxylate |
| InChI | InChI=1S/C8H7Cl2NO2/c1-2-13-8(12)5-3-4-11-7(10)6(5)9/h3-4H,2H2,1H3 |
| InChIKey | YOOGHVYYXXTYTN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC=C1)Cl)Cl |
