For research use only. Not for therapeutic Use.
Ethyl (2S)-2-hydroxybutanoate(Cat No.:L007644), is a chemical compound containing an ethyl ester group and a hydroxy group attached to a chiral carbon atom in a (2S)-configuration. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a key intermediate for the creation of various organic molecules, especially in the development of pharmaceuticals, flavors, and fragrances.
CAS Number | 88271-13-0 |
Molecular Formula | C6H12O3 |
Purity | ≥95% |
IUPAC Name | ethyl (2S)-2-hydroxybutanoate |
InChI | InChI=1S/C6H12O3/c1-3-5(7)6(8)9-4-2/h5,7H,3-4H2,1-2H3/t5-/m0/s1 |
InChIKey | KWWOQRSLYPHAMK-YFKPBYRVSA-N |
SMILES | CCC(C(=O)OCC)O |