For research use only. Not for therapeutic Use.
Ethyl 3-(3,5-Difluorophenyl)-3-oxopropanoate(Cat No.:L035912)is a versatile compound widely used in pharmaceutical and chemical research. This ester derivative, featuring a difluorophenyl group, is a key intermediate in the synthesis of complex organic molecules, including potential therapeutic agents. Its structure allows for diverse chemical modifications, making it valuable in medicinal chemistry and drug discovery. With high purity and stability, Ethyl 3-(3,5-Difluorophenyl)-3-oxopropanoate supports precise synthetic transformations, contributing to the development of bioactive compounds and enabling advanced research in drug development and organic synthesis.
CAS Number | 359424-42-3 |
Molecular Formula | C11H10F2O3 |
Purity | ≥95% |
IUPAC Name | ethyl 3-(3,5-difluorophenyl)-3-oxopropanoate |
InChI | InChI=1S/C11H10F2O3/c1-2-16-11(15)6-10(14)7-3-8(12)5-9(13)4-7/h3-5H,2,6H2,1H3 |
InChIKey | SJQAWRHMPXRCRM-UHFFFAOYSA-N |
SMILES | CCOC(=O)CC(=O)C1=CC(=CC(=C1)F)F |