For research use only. Not for therapeutic Use.
Ethyl 3-Aminobenzoate Methanesulfonate (Cat.No:R036334) is a chemical compound used as an intermediate in organic synthesis. It features an ethyl ester and a methanesulfonate group. This compound serves as a versatile building block for creating diverse molecules in pharmaceutical and chemical industries, facilitating the development of various compounds for research and applications.
CAS Number | 886-86-2 |
Synonyms | 3-Amino-benzoic Acid Ethyl Ester Methanesulfonate;?Ethyl m-Aminobenzoate Methanesulfonate; Finquel; MS 222; Metacain; Metacaine; NSC 93790; TS 222; Tricaine; Tricaine Methanesulfonate; |
Molecular Formula | C10H15NO5S |
Purity | ≥95% |
Target | Sodium Channel |
Solubility | Soluble in DMSO |
Storage | Room temperature |
IUPAC Name | ethyl 3-aminobenzoate;methanesulfonic acid |
InChI | InChI=1S/C9H11NO2.CH4O3S/c1-2-12-9(11)7-4-3-5-8(10)6-7;1-5(2,3)4/h3-6H,2,10H2,1H3;1H3,(H,2,3,4) |
InChIKey | FQZJYWMRQDKBQN-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC(=CC=C1)N.CS(=O)(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |