For research use only. Not for therapeutic Use.
Ethyl 3-bromo-1H-indole-2-carboxylate(Cat No.:L048630)is a brominated indole derivative featuring an ethyl ester group at the 2-position and a bromine atom at the 3-position on the indole ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other bioactive molecules. Its structure allows for versatile chemical modifications, making it valuable in medicinal chemistry and drug discovery. Ethyl 3-bromo-1H-indole-2-carboxylate is essential for researchers and chemists focused on developing novel compounds, offering high reactivity and stability in synthetic applications.
CAS Number | 91348-45-7 |
Molecular Formula | C11H10BrNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 3-bromo-1H-indole-2-carboxylate |
InChI | InChI=1S/C11H10BrNO2/c1-2-15-11(14)10-9(12)7-5-3-4-6-8(7)13-10/h3-6,13H,2H2,1H3 |
InChIKey | DRJWEOYWZOGNQU-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C2=CC=CC=C2N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |