For research use only. Not for therapeutic Use.
Ethyl 3-bromopyridine-2-carboxylate(CAT: L033948) is a high-purity brominated pyridine derivative with a carboxylate ester functionality. This versatile compound is widely used in pharmaceutical and chemical research as a key intermediate for the synthesis of complex organic molecules and bioactive compounds. Its bromine and ester groups provide unique reactivity, making it valuable in cross-coupling reactions and other advanced synthetic methodologies. With reliable quality and stability, Ethyl 3-bromopyridine-2-carboxylate is an essential tool for drug discovery, medicinal chemistry, and material science applications.
CAS Number | 434319-41-2 |
Molecular Formula | C8H8BrNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 3-bromopyridine-2-carboxylate |
InChI | InChI=1S/C8H8BrNO2/c1-2-12-8(11)7-6(9)4-3-5-10-7/h3-5H,2H2,1H3 |
InChIKey | FQVBRIVSBFQMQA-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C=CC=N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |