For research use only. Not for therapeutic Use.
Ethyl 3-hydroxy-2-methylbenzoate(Cat No.:L017191)is a versatile compound widely used in pharmaceutical and chemical research. As a methylated derivative of salicylic acid, it serves as an important building block in the synthesis of various bioactive molecules, including drugs and agrochemicals. Its unique structure, featuring both hydroxyl and ester functional groups, makes it ideal for creating more complex chemical entities. With its high purity and stability, Ethyl 3-hydroxy-2-methylbenzoate is crucial for applications requiring precise chemical modifications and consistent results in medicinal chemistry.
CAS Number | 141607-09-2 |
Molecular Formula | C10H12O3 |
Purity | ≥95% |
IUPAC Name | ethyl 3-hydroxy-2-methylbenzoate |
InChI | InChI=1S/C10H12O3/c1-3-13-10(12)8-5-4-6-9(11)7(8)2/h4-6,11H,3H2,1-2H3 |
InChIKey | WWTLEVOTRVPTOD-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C(=CC=C1)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |