For research use only. Not for therapeutic Use.
Ethyl 3-methyl-1H-indole-2-carboxylate(CAT: L042262) is an indole derivative commonly used as an intermediate in pharmaceutical and organic synthesis. This compound features a methyl group at the 3-position and an ethyl ester at the 2-carboxylate position of the indole ring, which contributes to its stability and lipophilicity. The indole core is a well-recognized scaffold in medicinal chemistry due to its bioactive properties, making this compound useful in developing bioactive molecules, such as receptor ligands and enzyme inhibitors. Its ester functionality allows for further modifications, including hydrolysis or esterification, making it adaptable for various synthetic pathways in drug discovery.
CAS Number | 26304-51-8 |
Molecular Formula | C12H13NO2 |
Purity | ≥95% |
IUPAC Name | ethyl 3-methyl-1H-indole-2-carboxylate |
InChI | InChI=1S/C12H13NO2/c1-3-15-12(14)11-8(2)9-6-4-5-7-10(9)13-11/h4-7,13H,3H2,1-2H3 |
InChIKey | OZQXZSIVKVCSDF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |