Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> Ethyl 3-methylpiperidine-3-carboxylate hydrochloride
For research use only. Not for therapeutic Use.
Ethyl 3-methylpiperidine-3-carboxylate hydrochloride (Cat.No:L035111) is a chemical compound used as a building block in organic synthesis. Its piperidine ring and ethyl ester group make it valuable for creating diverse molecules. This compound finds applications in pharmaceutical and chemical research, contributing to the development of various compounds for multiple purposes.
Catalog Number | L035111 |
CAS Number | 176523-95-8 |
Molecular Formula | C9H18ClNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 3-methylpiperidine-3-carboxylate;hydrochloride |
InChI | InChI=1S/C9H17NO2.ClH/c1-3-12-8(11)9(2)5-4-6-10-7-9;/h10H,3-7H2,1-2H3;1H |
InChIKey | IPAHPPZMOMRABY-UHFFFAOYSA-N |