For research use only. Not for therapeutic Use.
Ethyl 3-{[(tert-butoxy)carbonyl]amino}(Cat No.:L031689)is a chemical compound that combines an ethyl group and a tert-butoxycarbonyl (Boc) protected amino group. This structure is primarily used in peptide synthesis, where the Boc group serves as a protective group for the amino functionality, preventing unwanted reactions during the synthesis process. The ethyl group enhances solubility in organic solvents, facilitating its handling and use in various synthetic environments. The presence of the Boc group makes it easy to deprotect under mild acidic conditions, making this compound essential for stepwise construction of peptides in both research and industrial applications.
CAS Number | 88574-53-2 |
Molecular Formula | C10H19NO4 |
Purity | ≥95% |
IUPAC Name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
InChI | InChI=1S/C10H19NO4/c1-5-14-8(12)6-7-11-9(13)15-10(2,3)4/h5-7H2,1-4H3,(H,11,13) |
InChIKey | PARMXQJJKOUVHS-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCNC(=O)OC(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |