For research use only. Not for therapeutic Use.
Ethyl 3,4-bis(2-methoxyethoxy)benzoate (CAS 183322-16-9) has been used to synthesize <span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;"><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Erlotinib hydrochloride.</span></span></span>
| Catalog Number | M042532 |
| CAS Number | 183322-16-9 |
| Synonyms | 3,4-Bis(2-methoxyethoxy)benzoic acid ethyl ester; Benzoic acid, 3,4-bis(2-methoxyethoxy)-, ethyl ester |
| Molecular Formula | C15H22O6 |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | ethyl 3,4-bis(2-methoxyethoxy)benzoate |
| InChI | InChI=1S/C15H22O6/c1-4-19-15(16)12-5-6-13(20-9-7-17-2)14(11-12)21-10-8-18-3/h5-6,11H,4,7-10H2,1-3H3 |
| InChIKey | VGFZRAVMWXHEJB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)OCCOC)OCCOC |
| Reference | <span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">1.<span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Barghi, Leila, et al. "Modified synthesis of erlotinib hydrochloride." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Advanced pharmaceutical bulletin</i><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> 2.1 (2012): 119.</span></span></span> |
