Ethyl 3,4-dihydroxybenzoate(CAT: R049101) is an organic compound belonging to the ester family. Its mode of action involves serving as an ethyl ester derivative of 3,4-dihydroxybenzoic acid. This compound possesses pharmacological properties and is used in various applications, including as a chemical intermediate in organic synthesis and as an ingredient in cosmetics and personal care products. Moreover, it exhibits antioxidant activity, making it valuable in food preservation and as a potential pharmaceutical agent.
| Catalog Number | R049101 |
| CAS Number | 3943-89-3 |
| Synonyms | 3,4-Dihydroxybenzoic Acid Ethyl Ester; Protocatechuic Acid Ethyl Ester; Ethyl Protocatechuate; NSC 619681; NSC 86130; |
| Molecular Formula | C9H10O4 |
| Purity | 0% |
| Storage | Store at -20°C |
| IUPAC Name | ethyl 3,4-dihydroxybenzoate |
| InChI | InChI=1S/C9H10O4/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5,10-11H,2H2,1H3 |
| InChIKey | KBPUBCVJHFXPOC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)O)O |
