For research use only. Not for therapeutic Use.
Ethyl 3,5-dimethylbenzoate(Cat No.:L007140), is a chemical compound with the molecular formula C11H14O2. It is an ester, consisting of a benzoic acid derivative with two methyl groups at the 3rd and 5th positions, and an ethyl group attached to the carboxyl group. This compound is widely used in organic synthesis as a valuable building block, enabling the creation of various complex organic molecules. Its versatility makes it essential in the production of pharmaceuticals, flavoring agents, and fragrances, contributing significantly to the field of chemical research and various industries that rely on specialized organic compounds.
CAS Number | 21239-29-2 |
Molecular Formula | C11H14O2 |
Purity | ≥95% |
IUPAC Name | ethyl 3,5-dimethylbenzoate |
InChI | InChI=1S/C11H14O2/c1-4-13-11(12)10-6-8(2)5-9(3)7-10/h5-7H,4H2,1-3H3 |
InChIKey | IHAAVLXHNOZMBC-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC(=CC(=C1)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |