Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl 4-(1H-benzo[d][1,2,3]triazol-1-yl)butanoate
For research use only. Not for therapeutic Use.
Ethyl 4-(1H-benzo[d][1,2,3]triazol-1-yl)butanoate (Cat.No:L003972) is a crucial compound in pharmaceutical research. Its unique structure, incorporating a benzo[d][1,2,3]triazole ring, imparts distinct pharmacological potential. This compound serves as a valuable scaffold in the development of bioactive molecules, particularly in the field of medicinal chemistry. Its versatile reactivity and diverse applications underscore its importance in contemporary drug discovery, making it a significant candidate in the quest for novel therapeutic agents.
CAS Number | 69218-48-0 |
Molecular Formula | C12H15N3O2 |
Purity | ≥95% |
IUPAC Name | ethyl 4-(benzotriazol-1-yl)butanoate |
InChI | InChI=1S/C12H15N3O2/c1-2-17-12(16)8-5-9-15-11-7-4-3-6-10(11)13-14-15/h3-4,6-7H,2,5,8-9H2,1H3 |
InChIKey | UKDHGXVRHFMFTO-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCCN1C2=CC=CC=C2N=N1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |