Ethyl 4-(2-chloropyrimidin-4-yl)benzoate（Cat No.:L018396）is a specialized organic compound utilized primarily in pharmaceutical research. This ester derivative features a chloropyrimidine ring attached to a benzoate moiety, making it an important building block for synthesizing various biologically active molecules. Its unique structure enables the development of novel therapeutic agents, particularly in the areas of oncology and anti-inflammatory drug research. With high purity and consistent performance, this compound is ideal for researchers aiming to explore new avenues in medicinal chemistry and drug discovery.
| Catalog Number | L018396 |
| CAS Number | 499195-60-7 |
| Molecular Formula | C13H11ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 4-(2-chloropyrimidin-4-yl)benzoate |
| InChI | InChI=1S/C13H11ClN2O2/c1-2-18-12(17)10-5-3-9(4-6-10)11-7-8-15-13(14)16-11/h3-8H,2H2,1H3 |
| InChIKey | PTSZMMLYAGLVQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=NC(=NC=C2)Cl |
