For research use only. Not for therapeutic Use.
Ethyl 4-(2,2,2-trifluoroacetyl)benzoate(CAT; L035043) is a fluorinated aromatic ester featuring a trifluoroacetyl group on the benzene ring and an ethyl ester functionality. This compound is highly valuable in pharmaceutical and materials research, serving as a versatile intermediate in the synthesis of complex molecules, including fluorinated drugs and agrochemicals. Its unique combination of electron-withdrawing properties and aromatic stability makes it ideal for applications in medicinal chemistry and fluorinated compound development. With excellent purity and reliability, Ethyl 4-(2,2,2-trifluoroacetyl)benzoate supports advanced research in organic synthesis and innovative chemical applications.
CAS Number | 898787-14-9 |
Molecular Formula | C11H9F3O3 |
Purity | ≥95% |
IUPAC Name | ethyl 4-(2,2,2-trifluoroacetyl)benzoate |
InChI | InChI=1S/C11H9F3O3/c1-2-17-10(16)8-5-3-7(4-6-8)9(15)11(12,13)14/h3-6H,2H2,1H3 |
InChIKey | MSPQBVVINOKAFC-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |