For research use only. Not for therapeutic Use.
Ethyl 4-(4-bromophenyl)butanoate is an organic compound used in synthetic organic chemistry and pharmaceutical research. Featuring an ethyl ester group and a para-bromophenyl substituent on the butanoate backbone, this compound serves as an important intermediate in the synthesis of various bioactive molecules. Its structure allows for potential applications in drug development, particularly in the design of compounds with anti-inflammatory or analgesic properties. Additionally, it is valuable in chemical reactions requiring functionalized building blocks for further transformations.
CAS Number | 105986-54-7 |
Molecular Formula | C12H15BrO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 4-(4-bromophenyl)butanoate |
InChI | InChI=1S/C12H15BrO2/c1-2-15-12(14)5-3-4-10-6-8-11(13)9-7-10/h6-9H,2-5H2,1H3 |
InChIKey | KCLNIIVASYXCES-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCCC1=CC=C(C=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |