For research use only. Not for therapeutic Use.
Ethyl 4-amino-2-nitrobenzoate(Cat No.:L014390)is a chemical compound featuring a benzoate ester linked with both amino and nitro substituents. This structure imparts significant reactivity, making it a valuable intermediate in the synthesis of dyes, pharmaceuticals, and other organic molecules. The nitro group offers sites for reduction reactions, while the amino group can be involved in coupling reactions, enhancing the compound’s versatility in chemical synthesis. Its ethyl ester group increases solubility in organic solvents, facilitating its use in various synthetic applications. This compound is instrumental in producing materials with specific optical and biological properties.
CAS Number | 84228-46-6 |
Molecular Formula | C9H10N2O4 |
Purity | ≥95% |
IUPAC Name | ethyl 4-amino-2-nitrobenzoate |
InChI | InChI=1S/C9H10N2O4/c1-2-15-9(12)7-4-3-6(10)5-8(7)11(13)14/h3-5H,2,10H2,1H3 |
InChIKey | YOMQIQZTFBDFSR-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C=C(C=C1)N)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |