Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl 4-chloro-5-(trifluoromethyl)quinoline-3-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 4-chloro-5-(trifluoromethyl)quinoline-3-carboxylate (Cat.No:L004181) is a crucial compound in pharmaceutical research. Its distinct structure, featuring a chloroquinoline core with a trifluoromethyl substituent, grants it unique reactivity. This compound serves as a valuable scaffold in the development of bioactive molecules, particularly in the field of medicinal chemistry.
CAS Number | 2177266-12-3 |
Molecular Formula | C13H9ClF3NO2 |
Purity | ≥95% |
IUPAC Name | ethyl 4-chloro-5-(trifluoromethyl)quinoline-3-carboxylate |
InChI | InChI=1S/C13H9ClF3NO2/c1-2-20-12(19)7-6-18-9-5-3-4-8(13(15,16)17)10(9)11(7)14/h3-6H,2H2,1H3 |
InChIKey | USBKHXKUSCFHGP-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C2=C(C=CC=C2N=C1)C(F)(F)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |