For research use only. Not for therapeutic Use.
Ethyl 4-[(chloroacetyl)amino]benzoate(Cat No.:L046502)is an organic compound widely used in pharmaceutical and chemical research. This molecule features a chloroacetyl group attached to an aminobenzoate core, making it a valuable intermediate in synthesizing various bioactive compounds, including potential drugs and agrochemicals. The presence of both ester and amide functionalities enhances its reactivity, enabling the creation of complex molecular architectures. Ethyl 4-[(chloroacetyl)amino]benzoate is particularly useful in developing new therapeutic agents and exploring novel chemical reactions in medicinal chemistry and synthetic organic chemistry.
CAS Number | 26226-72-2 |
Molecular Formula | C11H12ClNO3 |
Purity | ≥95% |
IUPAC Name | ethyl 4-[(2-chloroacetyl)amino]benzoate |
InChI | InChI=1S/C11H12ClNO3/c1-2-16-11(15)8-3-5-9(6-4-8)13-10(14)7-12/h3-6H,2,7H2,1H3,(H,13,14) |
InChIKey | ZVRJEYAQESBSSH-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |