For research use only. Not for therapeutic Use.
Ethyl 4-fluoro-3-nitrobenzoate(Cat No.:L047147)is a high-purity aromatic ester widely used in pharmaceutical and chemical research. This compound features a fluorine atom and a nitro group on a benzoate core, with an ethyl ester functional group, making it a valuable intermediate in the synthesis of bioactive molecules, including drug candidates and fine chemicals. Its unique substitution pattern allows for selective reactivity in various chemical transformations. Ethyl 4-fluoro-3-nitrobenzoate is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
CAS Number | 367-80-6 |
Molecular Formula | C9H8FNO4 |
Purity | ≥95% |
IUPAC Name | ethyl 4-fluoro-3-nitrobenzoate |
InChI | InChI=1S/C9H8FNO4/c1-2-15-9(12)6-3-4-7(10)8(5-6)11(13)14/h3-5H,2H2,1H3 |
InChIKey | YONVBKVUSUGBQR-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC(=C(C=C1)F)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |