For research use only. Not for therapeutic Use.
Ethyl 4-methyl-1H-pyrazole-5-carboxylate(Cat No.:L039997)is a high-purity heterocyclic ester commonly used in pharmaceutical and chemical research. This compound, featuring a methyl-substituted pyrazole ring and an ethyl ester group, serves as a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure enables specific reactivity, facilitating diverse chemical transformations. Ethyl 4-methyl-1H-pyrazole-5-carboxylate is ideal for precise synthetic applications, making it an essential building block in medicinal chemistry and the development of novel therapeutic agents.
CAS Number | 6076-12-6 |
Molecular Formula | C7H10N2O2 |
Purity | ≥95% |
IUPAC Name | ethyl 4-methyl-1H-pyrazole-5-carboxylate |
InChI | InChI=1S/C7H10N2O2/c1-3-11-7(10)6-5(2)4-8-9-6/h4H,3H2,1-2H3,(H,8,9) |
InChIKey | QIBGZMYYGTXSQD-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C=NN1)C |