For research use only. Not for therapeutic Use.
Ethyl 4-nitrobutanoate(Cat No.:L007245), is an organic compound with the molecular formula C6H11NO4. It is a nitro derivative of butanoic acid, featuring a nitro group (NO2) attached to the fourth carbon atom in a butanoate chain. This compound finds applications in organic synthesis as a versatile building block. Chemists use it to introduce the nitro functionality into various molecules, enabling the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Its strategic placement of functional groups allows for further transformations, making it a valuable intermediate in the creation of complex organic compounds.
CAS Number | 2832-16-8 |
Molecular Formula | C6H11NO4 |
Purity | ≥95% |
IUPAC Name | ethyl 4-nitrobutanoate |
InChI | InChI=1S/C6H11NO4/c1-2-11-6(8)4-3-5-7(9)10/h2-5H2,1H3 |
InChIKey | JDCIBQNRJNANBE-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCC[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |