For research use only. Not for therapeutic Use.
Ethyl 4-nitrophenyl glyoxylate(Cat No.:L007141), is a chemical compound with the molecular formula C10H9NO5. It consists of a phenyl ring substituted with a nitro group at the 4th position, connected to a glyoxylate moiety, which is an α-keto acid derivative. This compound is significant in organic synthesis and medicinal chemistry, often used as a key intermediate in the creation of various biologically active compounds and pharmaceuticals. Its unique structure and reactivity make it valuable in drug discovery research, contributing to the development of potential therapeutic agents and advancements in the pharmaceutical industry.
CAS Number | 70091-75-7 |
Molecular Formula | C10H9NO5 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(4-nitrophenyl)-2-oxoacetate |
InChI | InChI=1S/C10H9NO5/c1-2-16-10(13)9(12)7-3-5-8(6-4-7)11(14)15/h3-6H,2H2,1H3 |
InChIKey | ZFCXKZCKJZFZGR-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |