Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl 4-(trifluoromethyl)thiazole-2-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 4-(trifluoromethyl)thiazole-2-carboxylate is a thiazole derivative featuring a trifluoromethyl group at the 4-position and an ethyl ester at the carboxylate position. This compound is significant in organic synthesis and medicinal chemistry, known for its potential biological activities, including antifungal and antimicrobial properties. The trifluoromethyl group enhances lipophilicity and metabolic stability, while the ethyl ester facilitates further chemical transformations. Its unique structure allows for versatile modifications, making it valuable in the development of novel therapeutic agents and agrochemicals.
CAS Number | 79247-86-2 |
Molecular Formula | C7H6F3NO2S |
Purity | ≥95% |
IUPAC Name | ethyl 4-(trifluoromethyl)-1,3-thiazole-2-carboxylate |
InChI | InChI=1S/C7H6F3NO2S/c1-2-13-6(12)5-11-4(3-14-5)7(8,9)10/h3H,2H2,1H3 |
InChIKey | PSTFYCCCZHOTHW-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=NC(=CS1)C(F)(F)F |