For research use only. Not for therapeutic Use.
Ethyl 5-amino-1-(3-chlorophenyl)-1H-pyrazole-4-carboxylate is a pyrazole derivative notable for its potential pharmacological applications. Featuring an amino group and a chlorophenyl substituent, this compound is of interest in medicinal chemistry for its possible anti-inflammatory and analgesic properties. The carboxylate group enhances its solubility and reactivity, making it suitable for further chemical modifications. Researchers explore its role in synthesizing novel therapeutic agents, aiming to develop drugs that target specific biological pathways or conditions, thus highlighting its significance in drug discovery.
Catalog Number | M065662 |
CAS Number | 15001-08-8 |
Molecular Formula | C12H12ClN3O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 5-amino-1-(3-chlorophenyl)pyrazole-4-carboxylate |
InChI | InChI=1S/C12H12ClN3O2/c1-2-18-12(17)10-7-15-16(11(10)14)9-5-3-4-8(13)6-9/h3-7H,2,14H2,1H3 |
InChIKey | CQYOTMSWCKDYTD-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC(=CC=C2)Cl)N |