For research use only. Not for therapeutic Use.
Ethyl 5-bromo-1H-pyrrole-2-carboxylate(Cat No.:L036839)is a chemical compound with the formula C7H8BrNO2, featuring a pyrrole ring substituted with a bromine atom and an ethyl carboxylate group. This structure makes it a valuable intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. Its bromo and carboxylate functionalities facilitate diverse chemical reactions, including coupling and substitution, essential for constructing complex molecular architectures. It’s especially useful in the synthesis of heterocyclic compounds, where it contributes to developing new drugs and agrochemical products with enhanced activity and stability.
CAS Number | 740813-37-0 |
Molecular Formula | C7H8BrNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 5-bromo-1H-pyrrole-2-carboxylate |
InChI | InChI=1S/C7H8BrNO2/c1-2-11-7(10)5-3-4-6(8)9-5/h3-4,9H,2H2,1H3 |
InChIKey | MAWSPHLRAHWQKY-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC=C(N1)Br |