For research use only. Not for therapeutic Use.
Ethyl 5-bromo-2-(methylthio)pyrimidine-4-carboxylate is a pyrimidine derivative featuring a bromine atom at the fifth position and a methylthio group at the second position, along with an ethyl ester at the carboxylate. This compound combines key functional groups that enhance its reactivity and potential as a synthetic intermediate. It is of interest in pharmaceutical research for its potential biological activities, including antimicrobial properties. The structure allows for various transformations, contributing to the development of novel therapeutic agents and chemical applications.
| Catalog Number | L039105 |
| CAS Number | 74840-38-3 |
| Molecular Formula | C8H9BrN2O2S |
| Purity | ≥95% |
| IUPAC Name | ethyl 5-bromo-2-methylsulfanylpyrimidine-4-carboxylate |
| InChI | InChI=1S/C8H9BrN2O2S/c1-3-13-7(12)6-5(9)4-10-8(11-6)14-2/h4H,3H2,1-2H3 |
| InChIKey | HAZCVNCWMFKYJI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NC=C1Br)SC |
