For research use only. Not for therapeutic Use.
Ethyl 5-bromothiophene-3-carboxylate (Cat No.:M132061) is a chemical compound belonging to the thiophene derivative class. Also known as ethyl 5-bromo-1,3-thiophene-2-carboxylate, it finds applications in organic synthesis and medicinal chemistry. It serves as a valuable building block for the synthesis of various compounds, including pharmaceutical intermediates and agrochemicals. Ethyl 5-bromothiophene-3-carboxylate can undergo diverse chemical reactions, allowing the creation of complex molecules with modified properties.
CAS Number | 170355-38-1 |
Molecular Formula | C7H7BrO2S |
Purity | ≥95% |
Storage | under inert gas (nitrogen or Argon) at 2–8 °C |
IUPAC Name | ethyl 5-bromothiophene-3-carboxylate |
InChI | InChI=1S/C7H7BrO2S/c1-2-10-7(9)5-3-6(8)11-4-5/h3-4H,2H2,1H3 |
InChIKey | LUYMKCLOYODOEI-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CSC(=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |