For research use only. Not for therapeutic Use.
Ethyl 5-(chlorosulfonyl)-2-fluorobenzoate(Cat No.:L007434) is a chemical compound. This compound consists of an ethyl ester group attached to a benzene ring with a sulfonyl chloride (chlorosulfonyl) substituent at position 5 and a fluorine atom at position 2. Compounds with sulfonyl chloride functional groups are often utilized in organic synthesis as reactive intermediates, enabling the introduction of sulfonyl groups into various organic molecules. This specific compound with its unique fluorine substitution holds potential applications in the development of specialty chemicals and pharmaceuticals.
CAS Number | 1155985-73-1 |
Molecular Formula | C9H8ClFO4S |
Purity | ≥95% |
IUPAC Name | ethyl 5-chlorosulfonyl-2-fluorobenzoate |
InChI | InChI=1S/C9H8ClFO4S/c1-2-15-9(12)7-5-6(16(10,13)14)3-4-8(7)11/h3-5H,2H2,1H3 |
InChIKey | BMQDSKFCJIXCIF-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C=CC(=C1)S(=O)(=O)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |