For research use only. Not for therapeutic Use.
Ethyl 5-cyanopicolinate is a chemical compound with diverse applications in organic synthesis. This ester derivative of 5-cyanopicolinic acid serves as a versatile building block in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure and reactivity make it valuable in medicinal chemistry, particularly in the synthesis of heterocyclic compounds and biologically active molecules. Additionally, ethyl 5-cyanopicolinate finds use as a ligand in coordination chemistry and as a precursor in the synthesis of various organic compounds, contributing to its significance in synthetic chemistry.
| Catalog Number | R065902 |
| CAS Number | 41051-03-0 |
| Molecular Formula | C9H8N2O2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 5-cyanopyridine-2-carboxylate |
| InChI | InChI=1S/C9H8N2O2/c1-2-13-9(12)8-4-3-7(5-10)6-11-8/h3-4,6H,2H2,1H3 |
| InChIKey | GXSJSHGZQTWJLG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C=C1)C#N |
