Home
>
Chemical Reagents>Organic Building Blocks> Ethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate(CAT: L000491) is a key compound in pharmaceutical research. This chemical exhibits promising actions as a potential drug candidate, particularly in the field of medicinal chemistry. Its unique structure and functional groups make it a valuable building block for the synthesis of novel pharmaceutical agents.
CAS Number | 1823383-20-5 |
Molecular Formula | C12H13FO2 |
Purity | ≥95% |
IUPAC Name | ethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate |
InChI | InChI=1S/C12H13FO2/c1-2-15-12(14)10-5-8-3-4-11(13)7-9(8)6-10/h3-4,7,10H,2,5-6H2,1H3 |
InChIKey | JOFPGKPZJXJHTD-UHFFFAOYSA-N |