For research use only. Not for therapeutic Use.
Ethyl 5-(hydroxymethyl)picolinate is an organic compound featuring a picolinate core with a hydroxymethyl group at the 5-position and an ethyl ester group. It is commonly used in pharmaceutical research and organic synthesis as a versatile building block for creating bioactive molecules, including drug candidates. The hydroxymethyl group offers a reactive site for further chemical modifications, while the picolinate structure is valuable for forming coordination complexes. This compound contributes to advancements in medicinal chemistry and the development of therapeutic agents.
| Catalog Number | L034147 |
| CAS Number | 50501-35-4 |
| Molecular Formula | C9H11NO3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 5-(hydroxymethyl)pyridine-2-carboxylate |
| InChI | InChI=1S/C9H11NO3/c1-2-13-9(12)8-4-3-7(6-11)5-10-8/h3-5,11H,2,6H2,1H3 |
| InChIKey | IFEFSAVXWIHYIT-UHFFFAOYSA-N |
