For research use only. Not for therapeutic Use.
Ethyl 5-iodopentanoate(CAR: L003100) is a high-purity iodinated ester featuring a pentanoate backbone with an iodine atom at the terminal position. This versatile compound serves as a valuable intermediate in organic synthesis and pharmaceutical research, particularly for constructing complex molecules and bioactive derivatives. Its terminal iodine atom facilitates nucleophilic substitutions, cross-coupling reactions, and other targeted transformations, while the ethyl ester group provides a reactive site for further functionalization. Ethyl 5-iodopentanoate is highly stable and reactive, making it an essential building block for medicinal chemistry, agrochemical development, and the synthesis of specialty materials.
CAS Number | 41302-32-3 |
Molecular Formula | C7H13IO2 |
Purity | ≥95% |
IUPAC Name | ethyl 5-iodopentanoate |
InChI | InChI=1S/C7H13IO2/c1-2-10-7(9)5-3-4-6-8/h2-6H2,1H3 |
InChIKey | RUVQSRJJSDAXER-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCCCI |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |