For research use only. Not for therapeutic Use.
Ethyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate(Cat No.:L007123), is a chemical compound with the molecular formula C13H14O4. It features a benzofuran ring substituted with a methoxy group (-OCH3) at the 5th position, a methyl group (-CH3) at the 3rd position, and an ethyl ester group (-COOCH2CH3) at the 2nd position. This compound is utilized in organic synthesis and medicinal chemistry research, often serving as a valuable intermediate in the creation of complex molecules. Its unique structure makes it significant in drug discovery efforts, enabling the development of potential therapeutic agents and contributing to advancements in the pharmaceutical industry.
CAS Number | 3710-50-7 |
Molecular Formula | C13H14O4 |
Purity | ≥95% |
IUPAC Name | ethyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
InChI | InChI=1S/C13H14O4/c1-4-16-13(14)12-8(2)10-7-9(15-3)5-6-11(10)17-12/h5-7H,4H2,1-3H3 |
InChIKey | DAETWRKPSJXAJB-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C2=C(O1)C=CC(=C2)OC)C |