For research use only. Not for therapeutic Use.
Ethyl 5-norbornene-2-carboxylate (mixture of endo and exo)(Cat No.:M121536)is a norbornene derivative where the bicyclic structure is modified with an ethyl carboxylate group. This compound, containing both endo and exo isomers, is particularly useful in materials science and polymer chemistry due to its ability to participate in ring-opening metathesis polymerization (ROMP). This process is vital for creating high-performance polymers with adjustable properties. The ethyl carboxylate group enhances solubility and reactivity, making this compound an effective monomer for synthesizing advanced materials with specific mechanical and chemical properties.
CAS Number | 10138-32-6 |
Molecular Formula | C10H14O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
InChI | InChI=1S/C10H14O2/c1-2-12-10(11)9-6-7-3-4-8(9)5-7/h3-4,7-9H,2,5-6H2,1H3 |
InChIKey | FCCGTJAGEHZPBF-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CC2CC1C=C2 |