Home
>
Chemical Reagents>Heterocyclic Building Blocks> ethyl 6-bromo-4-fluoro-1H-indole-2-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 6-bromo-4-fluoro-1H-indole-2-carboxylate(Cat No.:L007529), is a chemical compound with a molecular structure comprising an indole ring substituted with bromine, fluorine, and an ethyl ester group at the 6th, 4th, and 2nd positions, respectively. This compound is valuable in organic synthesis, serving as a key intermediate for creating complex organic molecules. Its unique structure makes it significant in pharmaceutical research, potentially serving as a building block for drug discovery. Researchers utilize it in the development of new drugs, exploring its reactivity and interactions with biological targets, contributing to advancements in medicinal chemistry and the creation of innovative pharmaceuticals.
CAS Number | 396075-55-1 |
Molecular Formula | C11H9BrFNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 6-bromo-4-fluoro-1H-indole-2-carboxylate |
InChI | InChI=1S/C11H9BrFNO2/c1-2-16-11(15)10-5-7-8(13)3-6(12)4-9(7)14-10/h3-5,14H,2H2,1H3 |
InChIKey | CWMMDFDMQCDTAB-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=C(N1)C=C(C=C2F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |