For research use only. Not for therapeutic Use.
Ethyl 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate hydrochloride(CAT: L000384) is a chemical compound with potential applications in organic chemistry. Its unique structure containing a benzoxazine core makes it a valuable intermediate for the synthesis of various organic molecules. In organic chemistry, it can be utilized as a key building block for creating compounds with specific functionalities or as an intermediate in the production of specialty chemicals.
CAS Number | 1432053-90-1 |
Molecular Formula | C11H13Cl2NO3 |
Purity | ≥95% |
IUPAC Name | ethyl 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate;hydrochloride |
InChI | InChI=1S/C11H12ClNO3.ClH/c1-2-15-11(14)10-6-13-8-5-7(12)3-4-9(8)16-10;/h3-5,10,13H,2,6H2,1H3;1H |
InChIKey | KGYYXCBSDUZCDI-UHFFFAOYSA-N |