For research use only. Not for therapeutic Use.
Ethyl 6-chloro-5-nitropicolinate(CAT: L049177) is a high-purity heterocyclic compound essential for advanced chemical and pharmaceutical research. Featuring a chloro and nitro-substituted pyridine ring with an ethyl ester functional group, this compound serves as a versatile intermediate in the synthesis of complex organic molecules, including drug candidates and agrochemical products. Its well-defined structure and reactivity make it ideal for applications in medicinal chemistry and fine chemical production. Ethyl 6-chloro-5-nitropicolinate ensures consistent performance and reliable results in diverse experimental setups, supporting innovation in drug discovery, materials science, and specialized chemical synthesis.
CAS Number | 1260669-90-6 |
Molecular Formula | C8H7ClN2O4 |
Purity | ≥95% |
IUPAC Name | ethyl 6-chloro-5-nitropyridine-2-carboxylate |
InChI | InChI=1S/C8H7ClN2O4/c1-2-15-8(12)5-3-4-6(11(13)14)7(9)10-5/h3-4H,2H2,1H3 |
InChIKey | OECGSTQDGXQUFO-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=NC(=C(C=C1)[N+](=O)[O-])Cl |