For research use only. Not for therapeutic Use.
Ethyl 6,7-dimethyl-1H-indole-2-carboxylate(Cat No.:L002720)is a chemically synthesized ester derivative of indole, featuring ethyl and dimethyl groups. This compound is crucial in medicinal chemistry for its potential as a building block in synthesizing various bioactive molecules, including alkaloids and pharmaceutical agents. Its structure allows for the exploration of interactions within biological systems, particularly in the modulation of neurotransmitter activity. Common applications include the synthesis of mood regulators and antipsychotic drugs. Its versatile framework makes it a fundamental component in drug discovery and development processes.
CAS Number | 187753-59-9 |
Molecular Formula | C13H15NO2 |
Purity | ≥95% |
IUPAC Name | ethyl 6,7-dimethyl-1H-indole-2-carboxylate |
InChI | InChI=1S/C13H15NO2/c1-4-16-13(15)11-7-10-6-5-8(2)9(3)12(10)14-11/h5-7,14H,4H2,1-3H3 |
InChIKey | NBKQKNZUPXLSKV-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=C(N1)C(=C(C=C2)C)C |