For research use only. Not for therapeutic Use.
Ethyl Acetate-d3 is a deuterated solvent widely used in NMR spectroscopy, offering precise analytical results due to its isotopic purity. This compound, labeled with three deuterium atoms, is ideal for pharmaceutical research, providing reliable data in studies involving reaction mechanisms and compound structures. Its stable isotope labeling ensures minimal background interference, making it an essential tool for high-precision experiments. Ethyl Acetate-d3 is crucial for chemists seeking accurate and reproducible results in their analytical and synthetic applications.
| CAS Number | 90691-33-1 |
| Synonyms | Acetic-2,2,2-d3 Acid Ethyl Ester; Acetic-d3 Acid Ethyl Ester; |
| Molecular Formula | C4H8O2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | ethyl 2,2,2-trideuterioacetate |
| InChI | InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3/i2D3 |
| InChIKey | XEKOWRVHYACXOJ-BMSJAHLVSA-N |
| SMILES | CCOC(=O)C |
