For research use only. Not for therapeutic Use.
Ethyl Acetoacetate-13C4 is a deuterated form of ethyl acetoacetate where four carbon atoms are replaced with the isotope 13C. This compound is used as an internal standard in mass spectrometry and NMR spectroscopy to enhance the precision of quantification and structural analysis. In organic chemistry, it supports studies on reaction mechanisms and isotopic labeling experiments. Its stable isotope labeling helps in the accurate tracking of carbon atoms during chemical reactions, making it valuable for analytical research and quality control in various chemical and pharmaceutical applications.
CAS Number | 84508-55-4 |
Synonyms | Ethyl acetoacetate-1,2,3,4-13C4;1-Ethoxybutane-1,3-dione-13C4; 3-Oxobutanoic Acid Ethyl Ester-13C4; 3-Oxobutyric Acid Ethyl Ester-13C4; Acetylacetic Acid Ethyl Ester-13C4; EAA-13C4; Ethyl 2-acetoacetate-13C4; Ethyl 2-methyl-3-oxopropionate-13C4; Ethy |
Molecular Formula | C6H10O3 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | ethyl 3-oxo(1,2,3,4-13C4)butanoate |
InChI | InChI=1S/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3/i2+1,4+1,5+1,6+1 |
InChIKey | XYIBRDXRRQCHLP-XMUWKQMQSA-N |
SMILES | CCO[13C](=O)[13CH2][13C](=O)[13CH3] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |