For research use only. Not for therapeutic Use.
Ethyl Acetoacetate (Cat.No:R020275) is a versatile organic compound widely used as a chemical intermediate in the synthesis of pharmaceuticals, agrochemicals, and perfumes. It serves as a building block in the production of various valuable compounds, including pyrazoles and pyridines, making it essential in the field of organic chemistry and industrial manufacturing.
| CAS Number | 141-97-9 |
| Synonyms | Ethyl acetoacetate-1,2,3,4; 1-Ethoxybutane-1,3-dione; 3-Oxobutanoic Acid Ethyl Ester; 3-Oxobutyric Acid Ethyl Ester; Acetylacetic Acid Ethyl Ester; EAA; Ethyl 2-Acetoacetate; Ethyl 2-Methyl-3-oxopropionate; Ethyl 3-Ketobutyrate; Ethyl 3-Oxobutanoate; |
| Molecular Formula | C6H10O3 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | ethyl 3-oxobutanoate |
| InChI | InChI=1S/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3 |
| InChIKey | XYIBRDXRRQCHLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C |
