For research use only. Not for therapeutic Use.
Ethyl Acetolactate (Cat No.:C001107) is a chemical compound with the systematic name ethyl 2,3-dihydroxybutanedioate. It is a colorless to pale yellow liquid with a sweet taste and a fruity aroma. Ethyl Acetolactate is used as a flavoring agent in the food and beverage industry, providing a buttery or caramel-like taste to various products. It is also utilized in the synthesis of various chemicals, including pharmaceutical intermediates.
| Catalog Number | C001107 |
| CAS Number | 16508-89-7 |
| Synonyms | Ethyl 2-Hydroxy-2-methyl-3-oxobutanoate; 2-Hydroxy-2-methyl-3-oxo-butanoic Acid Ethyl Ester; 2-Hydroxy-2-methyl-acetoacetic Acid Ethyl Ester; |
| Molecular Formula | C₇H₁₂O₄ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Colourless Oil |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | ethyl 2-hydroxy-4-oxopentanoate |
| InChI | InChI=1S/C7H12O4/c1-3-11-7(10)6(9)4-5(2)8/h6,9H,3-4H2,1-2H3 |
| InChIKey | KMGFCSZYXHRXSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(=O)C)O |
| Reference | Sayre, L. M., et al.: J. Org. Chem., 43, 4700-4705 (1978) |
