For research use only. Not for therapeutic Use.
Ethyl Arachate（Cat No.:R022450）is a high-purity ester of arachidic acid, commonly used in the production of cosmetics, personal care products, and industrial applications. It acts as an emollient, providing moisturizing and smoothing properties in skincare formulations. In chemical synthesis, Ethyl Arachate serves as an intermediate for producing other specialty chemicals and additives. Its stability and non-toxic nature make it valuable for enhancing the texture and consistency of various products. This compound is essential for advancing formulations in the cosmetic industry and supporting innovative applications in material science.
| Catalog Number | R022450 |
| CAS Number | 18281-05-5 |
| Synonyms | Ethyl Arachidate; Ethyl Eicosanoate; Ethyl Ester Arachidic Acid; Ethyl Ester Eicosanoic Acid; Ethyl Icosanoate |
| Molecular Formula | C22H44O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl icosanoate |
| InChI | InChI=1S/C22H44O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h3-21H2,1-2H3 |
| InChIKey | YBKSMWBLSBAFBQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCCCCCCC(=O)OCC |
