Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> Ethyl Bromoacetate-1,2-13C2
For research use only. Not for therapeutic Use.
Ethyl Bromoacetate-1,2-13C2 is an isotopically labeled compound where both carbon atoms in the bromoacetate group are enriched with the stable carbon-13 isotope. This compound is commonly used in research focused on organic synthesis, reaction mechanisms, and metabolic studies. The 13C labeling allows for precise tracking and analysis in NMR spectroscopy and mass spectrometry, making it an essential tool for studying the behavior and transformation of bromoacetates in chemical reactions. Researchers use Ethyl Bromoacetate-1,2-13C2 to gain insights into reaction kinetics, isotope effects, and the pathways involved in the formation of various organic compounds, thereby contributing to advancements in synthetic chemistry and pharmaceutical development.
CAS Number | 61898-49-5 |
Synonyms | Bromoacetic-13C2 Acid Ethyl Ester; Bromoacetic-13C2 Acid Ethyl Ester; Ethyl [1,2-13C2]Bromoacetate; |
Molecular Formula | C4H7BrO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 2-bromoacetate |
InChI | InChI=1S/C4H7BrO2/c1-2-7-4(6)3-5/h2-3H2,1H3/i3+1,4+1 |
InChIKey | PQJJJMRNHATNKG-CQDYUVAPSA-N |
SMILES | CCO[13C](=O)[13CH2]Br |