For research use only. Not for therapeutic Use.
Ethyl cellulose（Cat No.:I041252）is a cellulose derivative where some of the hydroxyl groups on the cellulose backbone are substituted with ethyl groups. It is a white, odorless, and tasteless powder that is soluble in organic solvents like ethanol and chloroform but insoluble in water. Ethyl cellulose is commonly used in pharmaceutical formulations as a binder, coating agent, and controlled-release excipient. It is also employed in food processing, cosmetics, and coatings due to its film-forming, thickening, and stabilizing properties. Additionally, it serves as a non-toxic, biodegradable alternative in various industrial applications.
| CAS Number | 9004-57-3 |
| Purity | ≥95% |
| IUPAC Name | 2-[4,5-diethoxy-2-(ethoxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol |
| InChI | InChI=1S/C20H38O11/c1-6-26-10-12-16(17(27-7-2)18(28-8-3)20(25-5)30-12)31-19-14(23)13(22)15(24-4)11(9-21)29-19/h11-23H,6-10H2,1-5H3 |
| InChIKey | ZZSNKZQZMQGXPY-UHFFFAOYSA-N |
| SMILES | CCOCC1C(C(C(C(O1)OC)OCC)OCC)OC2C(C(C(C(O2)CO)OC)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
