For research use only. Not for therapeutic Use.
Ethyl Cyanoethylphenylacetate is a notable compound in organic synthesis and pharmaceutical research, recognized for its role as an intermediate in the production of various bioactive molecules. Featuring both ethyl and cyano groups, this ester facilitates diverse chemical reactions, making it valuable for synthesizing complex compounds. Its structure allows for modifications that can enhance pharmacological properties, thereby expanding its potential applications in drug discovery. As a versatile building block, Ethyl Cyanoethylphenylacetate is integral to developing innovative therapeutic agents.
Catalog Number | R007611 |
CAS Number | 718-71-8 |
Synonyms | 2-Cyano-2-phenyl-butyric Acid Ethyl Ester; α-Cyano-α-ethyl-benzeneacetic Acid Ethyl Ester; NSC 6912; |
Molecular Formula | C13H15NO2 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | ethyl 2-cyano-2-phenylbutanoate |
InChI | InChI=1S/C13H15NO2/c1-3-13(10-14,12(15)16-4-2)11-8-6-5-7-9-11/h5-9H,3-4H2,1-2H3 |
InChIKey | VCJAUIYSQAXNGB-UHFFFAOYSA-N |
SMILES | CCC(C#N)(C1=CC=CC=C1)C(=O)OCC |